C13H17BrO2 — CID 65161378
2-[2-(2-bromo-4-methylphenoxy)ethyl]oxolane (PubChem CID 65161378) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is 2-[2-(2-bromo-4-methylphenoxy)ethyl]oxolane.
| Compound Name | 2-[2-(2-bromo-4-methylphenoxy)ethyl]oxolane |
|---|---|
| PubChem CID | 65161378 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-[2-(2-bromo-4-methylphenoxy)ethyl]oxolane |
| SMILES | Cc1ccc(OCCC2CCCO2)c(Br)c1 |
| InChI | InChI=1S/C13H17BrO2/c1-10-4-5-13(12(14)9-10)16-8-6-11-3-2-7-15-11/h4-5,9,11H,2-3,6-8H2,1H3 |
| InChIKey | XCJPDHSXTFLOLC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |