C15H16Br2O4 — CID 107739218
(E)-3-[3,5-dibromo-4-[2-(oxolan-2-yl)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 107739218) has the molecular formula C15H16Br2O4 and a molecular weight of 420.10 g/mol. Its IUPAC name is (E)-3-[3,5-dibromo-4-[2-(oxolan-2-yl)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dibromo-4-[2-(oxolan-2-yl)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107739218 |
| Molecular Formula | C15H16Br2O4 |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | (E)-3-[3,5-dibromo-4-[2-(oxolan-2-yl)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(Br)c(OCCC2CCCO2)c(Br)c1 |
| InChI | InChI=1S/C15H16Br2O4/c16-12-8-10(3-4-14(18)19)9-13(17)15(12)21-7-5-11-2-1-6-20-11/h3-4,8-9,11H,1-2,5-7H2,(H,18,19)/b4-3+ |
| InChIKey | VHBDKGIXZYEJJX-ONEGZZNKSA-N |
| XLogP | 4.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|