C16H19BrO4 — CID 77058018
3-[3-bromo-2-[3-(oxolan-2-yl)propoxy]phenyl]prop-2-enoic acid (PubChem CID 77058018) has the molecular formula C16H19BrO4 and a molecular weight of 355.23 g/mol. Its IUPAC name is 3-[3-bromo-2-[3-(oxolan-2-yl)propoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-bromo-2-[3-(oxolan-2-yl)propoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77058018 |
| Molecular Formula | C16H19BrO4 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 3-[3-bromo-2-[3-(oxolan-2-yl)propoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(Br)c1OCCCC1CCCO1 |
| InChI | InChI=1S/C16H19BrO4/c17-14-7-1-4-12(8-9-15(18)19)16(14)21-11-3-6-13-5-2-10-20-13/h1,4,7-9,13H,2-3,5-6,10-11H2,(H,18,19) |
| InChIKey | XQKDXVJEVZILLE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|