C14H16F2O3 — CID 79891317
3,5-difluoro-4-[3-(oxolan-2-yl)propoxy]benzaldehyde (PubChem CID 79891317) has the molecular formula C14H16F2O3 and a molecular weight of 270.27 g/mol. Its IUPAC name is 3,5-difluoro-4-[3-(oxolan-2-yl)propoxy]benzaldehyde.
| Compound Name | 3,5-difluoro-4-[3-(oxolan-2-yl)propoxy]benzaldehyde |
|---|---|
| PubChem CID | 79891317 |
| Molecular Formula | C14H16F2O3 |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3,5-difluoro-4-[3-(oxolan-2-yl)propoxy]benzaldehyde |
| SMILES | O=Cc1cc(F)c(OCCCC2CCCO2)c(F)c1 |
| InChI | InChI=1S/C14H16F2O3/c15-12-7-10(9-17)8-13(16)14(12)19-6-2-4-11-3-1-5-18-11/h7-9,11H,1-6H2 |
| InChIKey | GUKDDPHYNNXELR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|