C24H35NO2 — CID 40722253
(1R)-1-(1-adamantyl)-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]ethanamine (PubChem CID 40722253) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is (1R)-1-(1-adamantyl)-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]ethanamine.
| Compound Name | (1R)-1-(1-adamantyl)-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 40722253 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | (1R)-1-(1-adamantyl)-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]ethanamine |
| SMILES | C=CCOc1ccc(CN[C@H](C)C23CC4CC(CC(C4)C2)C3)cc1OCC |
| InChI | InChI=1S/C24H35NO2/c1-4-8-27-22-7-6-18(12-23(22)26-5-2)16-25-17(3)24-13-19-9-20(14-24)11-21(10-19)15-24/h4,6-7,12,17,19-21,25H,1,5,8-11,13-16H2,2-3H3/t17-,19?,20?,21?,24?/m1/s1 |
| InChIKey | MYBKFKSDOHXHQB-TVGZPFHWSA-N |
| XLogP | 5.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|