C23H32BrNO2 — CID 4715787
1-(1-adamantyl)-N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]ethanamine (PubChem CID 4715787) has the molecular formula C23H32BrNO2 and a molecular weight of 434.42 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]ethanamine.
| Compound Name | 1-(1-adamantyl)-N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 4715787 |
| Molecular Formula | C23H32BrNO2 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-(1-adamantyl)-N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]ethanamine |
| SMILES | C=CCOc1c(Br)cc(CNC(C)C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C23H32BrNO2/c1-4-5-27-22-20(24)9-19(10-21(22)26-3)14-25-15(2)23-11-16-6-17(12-23)8-18(7-16)13-23/h4,9-10,15-18,25H,1,5-8,11-14H2,2-3H3 |
| InChIKey | DAFRVSKAYITVMD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|