C27H34ClNO2 — CID 27209609
(1S)-1-(1-adamantyl)-N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine (PubChem CID 27209609) has the molecular formula C27H34ClNO2 and a molecular weight of 440.03 g/mol. Its IUPAC name is (1S)-1-(1-adamantyl)-N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine.
| Compound Name | (1S)-1-(1-adamantyl)-N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 27209609 |
| Molecular Formula | C27H34ClNO2 |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (1S)-1-(1-adamantyl)-N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine |
| SMILES | COc1cc(CN[C@@H](C)C23CC4CC(CC(C4)C2)C3)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H34ClNO2/c1-18(27-13-20-9-21(14-27)11-22(10-20)15-27)29-16-19-7-8-25(26(12-19)30-2)31-17-23-5-3-4-6-24(23)28/h3-8,12,18,20-22,29H,9-11,13-17H2,1-2H3/t18-,20?,21?,22?,27?/m0/s1 |
| InChIKey | GFFCPKBGDUNZCL-DPDSROAVSA-N |
| XLogP | 6.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |