C30H34ClNO — CID 27209522
(1S)-1-(1-adamantyl)-N-[[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methyl]ethanamine (PubChem CID 27209522) has the molecular formula C30H34ClNO and a molecular weight of 460.06 g/mol. Its IUPAC name is (1S)-1-(1-adamantyl)-N-[[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methyl]ethanamine.
| Compound Name | (1S)-1-(1-adamantyl)-N-[[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 27209522 |
| Molecular Formula | C30H34ClNO |
| Molecular Weight | 460.06 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (1S)-1-(1-adamantyl)-N-[[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methyl]ethanamine |
| SMILES | C[C@H](NCc1c(OCc2ccccc2Cl)ccc2ccccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H34ClNO/c1-20(30-15-21-12-22(16-30)14-23(13-21)17-30)32-18-27-26-8-4-2-6-24(26)10-11-29(27)33-19-25-7-3-5-9-28(25)31/h2-11,20-23,32H,12-19H2,1H3/t20-,21?,22?,23?,30?/m0/s1 |
| InChIKey | FKFVOYCSJGMUQP-PWHYTNLZSA-N |
| XLogP | 7.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.06 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |