C19H25Cl2NO4 — CID 17155273
2-[2-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylamino]ethoxy]ethanol;hydrochloride (PubChem CID 17155273) has the molecular formula C19H25Cl2NO4 and a molecular weight of 402.32 g/mol. Its IUPAC name is 2-[2-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylamino]ethoxy]ethanol;hydrochloride.
| Compound Name | 2-[2-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylamino]ethoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17155273 |
| Molecular Formula | C19H25Cl2NO4 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-[2-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylamino]ethoxy]ethanol;hydrochloride |
| SMILES | COc1cc(CNCCOCCO)cc(Cl)c1OCc1ccccc1.Cl |
| InChI | InChI=1S/C19H24ClNO4.ClH/c1-23-18-12-16(13-21-7-9-24-10-8-22)11-17(20)19(18)25-14-15-5-3-2-4-6-15;/h2-6,11-12,21-22H,7-10,13-14H2,1H3;1H |
| InChIKey | IFJPYTLRSSJHAU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|