C16H18Cl3NO2 — CID 17196015
2-[(3,5-dichloro-4-phenylmethoxyphenyl)methylamino]ethanol;hydrochloride (PubChem CID 17196015) has the molecular formula C16H18Cl3NO2 and a molecular weight of 362.68 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-phenylmethoxyphenyl)methylamino]ethanol;hydrochloride.
| Compound Name | 2-[(3,5-dichloro-4-phenylmethoxyphenyl)methylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17196015 |
| Molecular Formula | C16H18Cl3NO2 |
| Molecular Weight | 362.68 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-[(3,5-dichloro-4-phenylmethoxyphenyl)methylamino]ethanol;hydrochloride |
| SMILES | Cl.OCCNCc1cc(Cl)c(OCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2NO2.ClH/c17-14-8-13(10-19-6-7-20)9-15(18)16(14)21-11-12-4-2-1-3-5-12;/h1-5,8-9,19-20H,6-7,10-11H2;1H |
| InChIKey | TZTPNENYJMUFSG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.68 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|