C29H30N2O3S — CID 175217089
3-[3-(2-methoxy-5-methylphenyl)-5-methyl-2-oxo-1,3-thiazol-4-yl]-N-(4-phenylbutyl)benzamide (PubChem CID 175217089) has the molecular formula C29H30N2O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is 3-[3-(2-methoxy-5-methylphenyl)-5-methyl-2-oxo-1,3-thiazol-4-yl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 3-[3-(2-methoxy-5-methylphenyl)-5-methyl-2-oxo-1,3-thiazol-4-yl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 175217089 |
| Molecular Formula | C29H30N2O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 3-[3-(2-methoxy-5-methylphenyl)-5-methyl-2-oxo-1,3-thiazol-4-yl]-N-(4-phenylbutyl)benzamide |
| SMILES | COc1ccc(C)cc1-n1c(-c2cccc(C(=O)NCCCCc3ccccc3)c2)c(C)sc1=O |
| InChI | InChI=1S/C29H30N2O3S/c1-20-15-16-26(34-3)25(18-20)31-27(21(2)35-29(31)33)23-13-9-14-24(19-23)28(32)30-17-8-7-12-22-10-5-4-6-11-22/h4-6,9-11,13-16,18-19H,7-8,12,17H2,1-3H3,(H,30,32) |
| InChIKey | YJYQVKFQYWKRNS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|