C29H32N4O3 — CID 141473878
3-[2-(2,4-dimethoxyphenyl)-5-ethyl-1,2,4-triazol-3-yl]-N-(4-phenylbutyl)benzamide (PubChem CID 141473878) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-[2-(2,4-dimethoxyphenyl)-5-ethyl-1,2,4-triazol-3-yl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 3-[2-(2,4-dimethoxyphenyl)-5-ethyl-1,2,4-triazol-3-yl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 141473878 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 3-[2-(2,4-dimethoxyphenyl)-5-ethyl-1,2,4-triazol-3-yl]-N-(4-phenylbutyl)benzamide |
| SMILES | CCc1nc(-c2cccc(C(=O)NCCCCc3ccccc3)c2)n(-c2ccc(OC)cc2OC)n1 |
| InChI | InChI=1S/C29H32N4O3/c1-4-27-31-28(33(32-27)25-17-16-24(35-2)20-26(25)36-3)22-14-10-15-23(19-22)29(34)30-18-9-8-13-21-11-6-5-7-12-21/h5-7,10-12,14-17,19-20H,4,8-9,13,18H2,1-3H3,(H,30,34) |
| InChIKey | LNQIBRZQUZFKTH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|