C26H26N4O2 — CID 155551978
3-[5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide (PubChem CID 155551978) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-[5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 3-[5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 155551978 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 3-[5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide |
| SMILES | COc1ccc(-c2ncnn2-c2cccc(C(=O)NCCCCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H26N4O2/c1-32-24-15-13-21(14-16-24)25-28-19-29-30(25)23-12-7-11-22(18-23)26(31)27-17-6-5-10-20-8-3-2-4-9-20/h2-4,7-9,11-16,18-19H,5-6,10,17H2,1H3,(H,27,31) |
| InChIKey | VBCPEUJSYLPTHY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|