C20H22N2O4S2 — CID 8728842
[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 3-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 8728842) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 3-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 3-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 8728842 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | [2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl] 3-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2CCCC2=O)c1)NCCSCc1cccs1 |
| InChI | InChI=1S/C20H22N2O4S2/c23-18(21-8-11-27-14-17-6-3-10-28-17)13-26-20(25)15-4-1-5-16(12-15)22-9-2-7-19(22)24/h1,3-6,10,12H,2,7-9,11,13-14H2,(H,21,23) |
| InChIKey | OYVDSZRXYIHFOC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|