C21H26N2O4 — CID 8727239
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 8727239) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 8727239 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 3-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2CCCC2=O)c1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C21H26N2O4/c24-19(22-12-11-16-6-2-1-3-7-16)15-27-21(26)17-8-4-9-18(14-17)23-13-5-10-20(23)25/h4,6,8-9,14H,1-3,5,7,10-13,15H2,(H,22,24) |
| InChIKey | KZLOAOGYVDCTOM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|