C14H14N4OS2 — CID 17408604
N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2H-benzotriazole-5-carboxamide (PubChem CID 17408604) has the molecular formula C14H14N4OS2 and a molecular weight of 318.43 g/mol. Its IUPAC name is N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 17408604 |
| Molecular Formula | C14H14N4OS2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(NCCSCc1cccs1)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C14H14N4OS2/c19-14(10-3-4-12-13(8-10)17-18-16-12)15-5-7-20-9-11-2-1-6-21-11/h1-4,6,8H,5,7,9H2,(H,15,19)(H,16,17,18) |
| InChIKey | DHJSTVYTMJWTLS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|