C14H14INOS2 — CID 46684444
4-iodo-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 46684444) has the molecular formula C14H14INOS2 and a molecular weight of 403.31 g/mol. Its IUPAC name is 4-iodo-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 4-iodo-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46684444 |
| Molecular Formula | C14H14INOS2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.96 |
| IUPAC Name | 4-iodo-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSCc1cccs1)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H14INOS2/c15-12-5-3-11(4-6-12)14(17)16-7-9-18-10-13-2-1-8-19-13/h1-6,8H,7,9-10H2,(H,16,17) |
| InChIKey | BVYKKSLQQGVRAA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|