C22H19N3O2S2 — CID 24515822
4-(4-oxoquinazolin-3-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 24515822) has the molecular formula C22H19N3O2S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 4-(4-oxoquinazolin-3-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 4-(4-oxoquinazolin-3-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 24515822 |
| Molecular Formula | C22H19N3O2S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 4-(4-oxoquinazolin-3-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSCc1cccs1)c1ccc(-n2cnc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C22H19N3O2S2/c26-21(23-11-13-28-14-18-4-3-12-29-18)16-7-9-17(10-8-16)25-15-24-20-6-2-1-5-19(20)22(25)27/h1-10,12,15H,11,13-14H2,(H,23,26) |
| InChIKey | VLURVKUVHFJGST-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|