C13H12N4O2 — CID 18126076
N-[2-(furan-2-yl)ethyl]-2H-benzotriazole-5-carboxamide (PubChem CID 18126076) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 18126076 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(NCCc1ccco1)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C13H12N4O2/c18-13(14-6-5-10-2-1-7-19-10)9-3-4-11-12(8-9)16-17-15-11/h1-4,7-8H,5-6H2,(H,14,18)(H,15,16,17) |
| InChIKey | VVVLYANFWBGTPQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |