C17H17N3O4 — CID 47051903
3-ethyl-N-[2-(furan-2-yl)ethyl]-2,4-dioxo-1H-quinazoline-7-carboxamide (PubChem CID 47051903) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 3-ethyl-N-[2-(furan-2-yl)ethyl]-2,4-dioxo-1H-quinazoline-7-carboxamide.
| Compound Name | 3-ethyl-N-[2-(furan-2-yl)ethyl]-2,4-dioxo-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 47051903 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 3-ethyl-N-[2-(furan-2-yl)ethyl]-2,4-dioxo-1H-quinazoline-7-carboxamide |
| SMILES | CCn1c(=O)[nH]c2cc(C(=O)NCCc3ccco3)ccc2c1=O |
| InChI | InChI=1S/C17H17N3O4/c1-2-20-16(22)13-6-5-11(10-14(13)19-17(20)23)15(21)18-8-7-12-4-3-9-24-12/h3-6,9-10H,2,7-8H2,1H3,(H,18,21)(H,19,23) |
| InChIKey | LYUQFTCNCBULSZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |