C8H11BrN2OS — CID 116846336
3-(5-bromothiophen-2-yl)-N'-methylpropanehydrazide (PubChem CID 116846336) has the molecular formula C8H11BrN2OS and a molecular weight of 263.16 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-N'-methylpropanehydrazide.
| Compound Name | 3-(5-bromothiophen-2-yl)-N'-methylpropanehydrazide |
|---|---|
| PubChem CID | 116846336 |
| Molecular Formula | C8H11BrN2OS |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-N'-methylpropanehydrazide |
| SMILES | CNNC(=O)CCc1ccc(Br)s1 |
| InChI | InChI=1S/C8H11BrN2OS/c1-10-11-8(12)5-3-6-2-4-7(9)13-6/h2,4,10H,3,5H2,1H3,(H,11,12) |
| InChIKey | NGQVDFVJHRMKQY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|