C12H20BrClN2OS — CID 119433779
4-(5-bromothiophen-2-yl)-N-[3-(methylamino)propyl]butanamide;hydrochloride (PubChem CID 119433779) has the molecular formula C12H20BrClN2OS and a molecular weight of 355.73 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-N-[3-(methylamino)propyl]butanamide;hydrochloride.
| Compound Name | 4-(5-bromothiophen-2-yl)-N-[3-(methylamino)propyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119433779 |
| Molecular Formula | C12H20BrClN2OS |
| Molecular Weight | 355.73 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-N-[3-(methylamino)propyl]butanamide;hydrochloride |
| SMILES | CNCCCNC(=O)CCCc1ccc(Br)s1.Cl |
| InChI | InChI=1S/C12H19BrN2OS.ClH/c1-14-8-3-9-15-12(16)5-2-4-10-6-7-11(13)17-10;/h6-7,14H,2-5,8-9H2,1H3,(H,15,16);1H |
| InChIKey | UVHZXLWWLUZMAC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.73 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|