C16H24BrNO2S — CID 115701308
4-(5-bromothiophen-2-yl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]butanamide (PubChem CID 115701308) has the molecular formula C16H24BrNO2S and a molecular weight of 374.34 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]butanamide.
| Compound Name | 4-(5-bromothiophen-2-yl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]butanamide |
|---|---|
| PubChem CID | 115701308 |
| Molecular Formula | C16H24BrNO2S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]butanamide |
| SMILES | O=C(CCCc1ccc(Br)s1)NCC1(CO)CCCCC1 |
| InChI | InChI=1S/C16H24BrNO2S/c17-14-8-7-13(21-14)5-4-6-15(20)18-11-16(12-19)9-2-1-3-10-16/h7-8,19H,1-6,9-12H2,(H,18,20) |
| InChIKey | KWBCJAHWIPPUHV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |