C21H27BrN2OS — CID 18284230
4-(5-bromothiophen-2-yl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide (PubChem CID 18284230) has the molecular formula C21H27BrN2OS and a molecular weight of 435.43 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide.
| Compound Name | 4-(5-bromothiophen-2-yl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 18284230 |
| Molecular Formula | C21H27BrN2OS |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide |
| SMILES | O=C(CCCc1ccc(Br)s1)NCc1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C21H27BrN2OS/c22-20-12-11-19(26-20)5-4-6-21(25)23-15-17-7-9-18(10-8-17)16-24-13-2-1-3-14-24/h7-12H,1-6,13-16H2,(H,23,25) |
| InChIKey | UVFCBMNXLUUOFG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |