C20H26N2O2S — CID 27889825
N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-thiophen-2-ylbutanamide (PubChem CID 27889825) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 27889825 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)NCc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c23-20(5-1-3-19-4-2-14-25-19)21-15-17-6-8-18(9-7-17)16-22-10-12-24-13-11-22/h2,4,6-9,14H,1,3,5,10-13,15-16H2,(H,21,23) |
| InChIKey | ULNCSIXFWHQPAE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |