C16H18BrNOS — CID 107233721
N-[[4-(bromomethyl)phenyl]methyl]-4-thiophen-2-ylbutanamide (PubChem CID 107233721) has the molecular formula C16H18BrNOS and a molecular weight of 352.30 g/mol. Its IUPAC name is N-[[4-(bromomethyl)phenyl]methyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[[4-(bromomethyl)phenyl]methyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 107233721 |
| Molecular Formula | C16H18BrNOS |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[[4-(bromomethyl)phenyl]methyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)NCc1ccc(CBr)cc1 |
| InChI | InChI=1S/C16H18BrNOS/c17-11-13-6-8-14(9-7-13)12-18-16(19)5-1-3-15-4-2-10-20-15/h2,4,6-10H,1,3,5,11-12H2,(H,18,19) |
| InChIKey | DJYDXESPGMSCON-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|