C18H29N3O — CID 119836186
4-(methylamino)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide (PubChem CID 119836186) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-(methylamino)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide.
| Compound Name | 4-(methylamino)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 119836186 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 4-(methylamino)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide |
| SMILES | CNCCCC(=O)NCc1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C18H29N3O/c1-19-11-5-6-18(22)20-14-16-7-9-17(10-8-16)15-21-12-3-2-4-13-21/h7-10,19H,2-6,11-15H2,1H3,(H,20,22) |
| InChIKey | PJKZDLXGVWORPQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|