C19H28FNO2 — CID 110310181
5-(4-fluorophenyl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pentanamide (PubChem CID 110310181) has the molecular formula C19H28FNO2 and a molecular weight of 321.44 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pentanamide.
| Compound Name | 5-(4-fluorophenyl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pentanamide |
|---|---|
| PubChem CID | 110310181 |
| Molecular Formula | C19H28FNO2 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pentanamide |
| SMILES | O=C(CCCCc1ccc(F)cc1)NCC1(CO)CCCCC1 |
| InChI | InChI=1S/C19H28FNO2/c20-17-10-8-16(9-11-17)6-2-3-7-18(23)21-14-19(15-22)12-4-1-5-13-19/h8-11,22H,1-7,12-15H2,(H,21,23) |
| InChIKey | DBTZMZQTBXPHPC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|