C11H8Br2OS2 — CID 71671757
1,3-bis(5-bromothiophen-2-yl)propan-1-one (PubChem CID 71671757) has the molecular formula C11H8Br2OS2 and a molecular weight of 380.13 g/mol. Its IUPAC name is 1,3-bis(5-bromothiophen-2-yl)propan-1-one.
| Compound Name | 1,3-bis(5-bromothiophen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 71671757 |
| Molecular Formula | C11H8Br2OS2 |
| Molecular Weight | 380.13 g/mol |
| Exact Mass | 377.84 |
| IUPAC Name | 1,3-bis(5-bromothiophen-2-yl)propan-1-one |
| SMILES | O=C(CCc1ccc(Br)s1)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H8Br2OS2/c12-10-5-2-7(15-10)1-3-8(14)9-4-6-11(13)16-9/h2,4-6H,1,3H2 |
| InChIKey | GWCQCDBJNSINRG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.13 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |