C10H10BrNO2S — CID 82124402
1-(aziridin-1-yl)-4-(5-bromothiophen-2-yl)butane-1,4-dione (PubChem CID 82124402) has the molecular formula C10H10BrNO2S and a molecular weight of 288.17 g/mol. Its IUPAC name is 1-(aziridin-1-yl)-4-(5-bromothiophen-2-yl)butane-1,4-dione.
| Compound Name | 1-(aziridin-1-yl)-4-(5-bromothiophen-2-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 82124402 |
| Molecular Formula | C10H10BrNO2S |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 1-(aziridin-1-yl)-4-(5-bromothiophen-2-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H10BrNO2S/c11-9-3-2-8(15-9)7(13)1-4-10(14)12-5-6-12/h2-3H,1,4-6H2 |
| InChIKey | KKYPVWOMNDGZRI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|