C14H23NOS — CID 116574838
8-amino-6,6-dimethyl-1-thiophen-2-yloctan-3-one (PubChem CID 116574838) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 8-amino-6,6-dimethyl-1-thiophen-2-yloctan-3-one.
| Compound Name | 8-amino-6,6-dimethyl-1-thiophen-2-yloctan-3-one |
|---|---|
| PubChem CID | 116574838 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 8-amino-6,6-dimethyl-1-thiophen-2-yloctan-3-one |
| SMILES | CC(C)(CCN)CCC(=O)CCc1cccs1 |
| InChI | InChI=1S/C14H23NOS/c1-14(2,9-10-15)8-7-12(16)5-6-13-4-3-11-17-13/h3-4,11H,5-10,15H2,1-2H3 |
| InChIKey | QKIRNPYQKCWXGR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |