C17H16N2O3S — CID 110733447
2-(1,3-dioxoisoindol-2-yl)-N-methyl-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 110733447) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-methyl-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-methyl-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 110733447 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-methyl-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | CN(CCc1cccs1)C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H16N2O3S/c1-18(9-8-12-5-4-10-23-12)15(20)11-19-16(21)13-6-2-3-7-14(13)17(19)22/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | NLLUYHLUFZOGHO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|