C21H18N2O3S2 — CID 46401942
3-(1,3-dioxoisoindol-2-yl)-N,N-bis(thiophen-2-ylmethyl)propanamide (PubChem CID 46401942) has the molecular formula C21H18N2O3S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N,N-bis(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N,N-bis(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 46401942 |
| Molecular Formula | C21H18N2O3S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N,N-bis(thiophen-2-ylmethyl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C21H18N2O3S2/c24-19(9-10-23-20(25)17-7-1-2-8-18(17)21(23)26)22(13-15-5-3-11-27-15)14-16-6-4-12-28-16/h1-8,11-12H,9-10,13-14H2 |
| InChIKey | NRKYBJCVHHFQFX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|