C19H17BrN2O3S — CID 55377058
3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 55377058) has the molecular formula C19H17BrN2O3S and a molecular weight of 433.33 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 55377058 |
| Molecular Formula | C19H17BrN2O3S |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)CCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C19H17BrN2O3S/c1-2-8-21(12-14-4-3-10-26-14)17(23)7-9-22-18(24)15-6-5-13(20)11-16(15)19(22)25/h2-6,10-11H,1,7-9,12H2 |
| InChIKey | IWWYTIRPPNBPEA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|