C20H19N2O2S2+ — CID 8800688
2-(1,3-dioxoisoindol-2-yl)ethyl-bis(thiophen-2-ylmethyl)azanium (PubChem CID 8800688) has the molecular formula C20H19N2O2S2+ and a molecular weight of 383.52 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl-bis(thiophen-2-ylmethyl)azanium.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl-bis(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8800688 |
| Molecular Formula | C20H19N2O2S2+ |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl-bis(thiophen-2-ylmethyl)azanium |
| SMILES | O=C1c2ccccc2C(=O)N1CC[NH+](Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C20H18N2O2S2/c23-19-17-7-1-2-8-18(17)20(24)22(19)10-9-21(13-15-5-3-11-25-15)14-16-6-4-12-26-16/h1-8,11-12H,9-10,13-14H2/p+1 |
| InChIKey | UKOCQOSTQKTJKI-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|