C14H14FNO3 — CID 177493952
(2S)-2-(1,3-dioxoisoindol-2-yl)-2-fluoro-4-methylpentanal (PubChem CID 177493952) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-2-fluoro-4-methylpentanal.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-2-fluoro-4-methylpentanal |
|---|---|
| PubChem CID | 177493952 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-2-fluoro-4-methylpentanal |
| SMILES | CC(C)C[C@](F)(C=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H14FNO3/c1-9(2)7-14(15,8-17)16-12(18)10-5-3-4-6-11(10)13(16)19/h3-6,8-9H,7H2,1-2H3/t14-/m1/s1 |
| InChIKey | YNAHHHMLGQKYHL-CQSZACIVSA-N |
| XLogP | 2.19 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|