C12H10FNO3 — CID 177398332
(2S)-2-(1,3-dioxoisoindol-2-yl)-2-fluorobutanal (PubChem CID 177398332) has the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-2-fluorobutanal.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-2-fluorobutanal |
|---|---|
| PubChem CID | 177398332 |
| Molecular Formula | C12H10FNO3 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-2-fluorobutanal |
| SMILES | CC[C@](F)(C=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H10FNO3/c1-2-12(13,7-15)14-10(16)8-5-3-4-6-9(8)11(14)17/h3-7H,2H2,1H3/t12-/m1/s1 |
| InChIKey | YAYLZBVLODPABF-GFCCVEGCSA-N |
| XLogP | 1.56 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|