C16H20N2O3 — CID 21497616
2-[3-(dimethylamino)-2-oxobutyl]isoindole-1,3-dione;ethene (PubChem CID 21497616) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-2-oxobutyl]isoindole-1,3-dione;ethene.
| Compound Name | 2-[3-(dimethylamino)-2-oxobutyl]isoindole-1,3-dione;ethene |
|---|---|
| PubChem CID | 21497616 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[3-(dimethylamino)-2-oxobutyl]isoindole-1,3-dione;ethene |
| SMILES | C=C.CC(C(=O)CN1C(=O)c2ccccc2C1=O)N(C)C |
| InChI | InChI=1S/C14H16N2O3.C2H4/c1-9(15(2)3)12(17)8-16-13(18)10-6-4-5-7-11(10)14(16)19;1-2/h4-7,9H,8H2,1-3H3;1-2H2 |
| InChIKey | MZOOUQAAUNVGRK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|