C22H24BrN3O3 — CID 17080403
N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]-2-indol-1-ylacetohydrazide (PubChem CID 17080403) has the molecular formula C22H24BrN3O3 and a molecular weight of 458.36 g/mol. Its IUPAC name is N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]-2-indol-1-ylacetohydrazide.
| Compound Name | N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]-2-indol-1-ylacetohydrazide |
|---|---|
| PubChem CID | 17080403 |
| Molecular Formula | C22H24BrN3O3 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N'-[2-(4-bromo-2-tert-butylphenoxy)acetyl]-2-indol-1-ylacetohydrazide |
| SMILES | CC(C)(C)c1cc(Br)ccc1OCC(=O)NNC(=O)Cn1ccc2ccccc21 |
| InChI | InChI=1S/C22H24BrN3O3/c1-22(2,3)17-12-16(23)8-9-19(17)29-14-21(28)25-24-20(27)13-26-11-10-15-6-4-5-7-18(15)26/h4-12H,13-14H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | CEVQRAOJTAQLIX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|