C20H22BrN3O4 — CID 17353041
N-benzyl-4-[2-(5-bromo-2-ethoxybenzoyl)hydrazinyl]-4-oxobutanamide (PubChem CID 17353041) has the molecular formula C20H22BrN3O4 and a molecular weight of 448.32 g/mol. Its IUPAC name is N-benzyl-4-[2-(5-bromo-2-ethoxybenzoyl)hydrazinyl]-4-oxobutanamide.
| Compound Name | N-benzyl-4-[2-(5-bromo-2-ethoxybenzoyl)hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 17353041 |
| Molecular Formula | C20H22BrN3O4 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-benzyl-4-[2-(5-bromo-2-ethoxybenzoyl)hydrazinyl]-4-oxobutanamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NNC(=O)CCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H22BrN3O4/c1-2-28-17-9-8-15(21)12-16(17)20(27)24-23-19(26)11-10-18(25)22-13-14-6-4-3-5-7-14/h3-9,12H,2,10-11,13H2,1H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | RFTCPDRLAGLAHL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|