C19H20Br2N2O4 — CID 4941221
2-butoxy-N'-[2-(2,4-dibromophenoxy)acetyl]benzohydrazide (PubChem CID 4941221) has the molecular formula C19H20Br2N2O4 and a molecular weight of 500.19 g/mol. Its IUPAC name is 2-butoxy-N'-[2-(2,4-dibromophenoxy)acetyl]benzohydrazide.
| Compound Name | 2-butoxy-N'-[2-(2,4-dibromophenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 4941221 |
| Molecular Formula | C19H20Br2N2O4 |
| Molecular Weight | 500.19 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | 2-butoxy-N'-[2-(2,4-dibromophenoxy)acetyl]benzohydrazide |
| SMILES | CCCCOc1ccccc1C(=O)NNC(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C19H20Br2N2O4/c1-2-3-10-26-16-7-5-4-6-14(16)19(25)23-22-18(24)12-27-17-9-8-13(20)11-15(17)21/h4-9,11H,2-3,10,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | PQMFSHOIQHFWOV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.19 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|