C14H10ClFN2O4S — CID 7146659
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate (PubChem CID 7146659) has the molecular formula C14H10ClFN2O4S and a molecular weight of 356.76 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate.
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7146659 |
| Molecular Formula | C14H10ClFN2O4S |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Cl)s1)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C14H10ClFN2O4S/c15-11-6-5-10(23-11)14(21)22-7-12(19)17-18-13(20)8-3-1-2-4-9(8)16/h1-6H,7H2,(H,17,19)(H,18,20) |
| InChIKey | JDMZSJQWGCZYAG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|