C11H11FN2O4 — CID 9198561
[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 3-fluorobenzoate (PubChem CID 9198561) has the molecular formula C11H11FN2O4 and a molecular weight of 254.22 g/mol. Its IUPAC name is [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 3-fluorobenzoate.
| Compound Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 9198561 |
| Molecular Formula | C11H11FN2O4 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 3-fluorobenzoate |
| SMILES | NC(=O)CNC(=O)COC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H11FN2O4/c12-8-3-1-2-7(4-8)11(17)18-6-10(16)14-5-9(13)15/h1-4H,5-6H2,(H2,13,15)(H,14,16) |
| InChIKey | XNXIVXPCAFCKBJ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |