C13H8BrFO3 — CID 82966938
1-(4-bromo-2-fluorophenyl)-3-(furan-2-yl)propane-1,3-dione (PubChem CID 82966938) has the molecular formula C13H8BrFO3 and a molecular weight of 311.11 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-(furan-2-yl)propane-1,3-dione.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-(furan-2-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 82966938 |
| Molecular Formula | C13H8BrFO3 |
| Molecular Weight | 311.11 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-(furan-2-yl)propane-1,3-dione |
| SMILES | O=C(CC(=O)c1ccc(Br)cc1F)c1ccco1 |
| InChI | InChI=1S/C13H8BrFO3/c14-8-3-4-9(10(15)6-8)11(16)7-12(17)13-2-1-5-18-13/h1-6H,7H2 |
| InChIKey | YUCDQZUYZYMXNY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.11 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|