C22H20BrFN2O3 — CID 51965230
N-[4-[[(S)-(4-bromo-2-fluorophenyl)-phenylmethyl]amino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 51965230) has the molecular formula C22H20BrFN2O3 and a molecular weight of 459.32 g/mol. Its IUPAC name is N-[4-[[(S)-(4-bromo-2-fluorophenyl)-phenylmethyl]amino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[[(S)-(4-bromo-2-fluorophenyl)-phenylmethyl]amino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51965230 |
| Molecular Formula | C22H20BrFN2O3 |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | N-[4-[[(S)-(4-bromo-2-fluorophenyl)-phenylmethyl]amino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccco1)N[C@@H](c1ccccc1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C22H20BrFN2O3/c23-16-10-11-17(18(24)14-16)21(15-6-2-1-3-7-15)26-20(27)9-4-12-25-22(28)19-8-5-13-29-19/h1-3,5-8,10-11,13-14,21H,4,9,12H2,(H,25,28)(H,26,27)/t21-/m0/s1 |
| InChIKey | FUSDAQWHOSKBPP-NRFANRHFSA-N |
| XLogP | 4.60 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|