C18H13BrFNO2 — CID 55857773
N-[(4-bromo-2-fluorophenyl)-phenylmethyl]furan-2-carboxamide (PubChem CID 55857773) has the molecular formula C18H13BrFNO2 and a molecular weight of 374.21 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)-phenylmethyl]furan-2-carboxamide.
| Compound Name | N-[(4-bromo-2-fluorophenyl)-phenylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55857773 |
| Molecular Formula | C18H13BrFNO2 |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)-phenylmethyl]furan-2-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccc(Br)cc1F)c1ccco1 |
| InChI | InChI=1S/C18H13BrFNO2/c19-13-8-9-14(15(20)11-13)17(12-5-2-1-3-6-12)21-18(22)16-7-4-10-23-16/h1-11,17H,(H,21,22) |
| InChIKey | GTGYMXCJHXQPOV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |