C24H19ClN4O4 — CID 55730289
[2-[[3-cyano-1-(furan-2-ylmethyl)-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate (PubChem CID 55730289) has the molecular formula C24H19ClN4O4 and a molecular weight of 462.89 g/mol. Its IUPAC name is [2-[[3-cyano-1-(furan-2-ylmethyl)-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-[[3-cyano-1-(furan-2-ylmethyl)-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55730289 |
| Molecular Formula | C24H19ClN4O4 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | [2-[[3-cyano-1-(furan-2-ylmethyl)-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
| SMILES | Cc1c(C#N)c(NC(=O)COC(=O)c2ccc3nc(Cl)ccc3c2)n(Cc2ccco2)c1C |
| InChI | InChI=1S/C24H19ClN4O4/c1-14-15(2)29(12-18-4-3-9-32-18)23(19(14)11-26)28-22(30)13-33-24(31)17-5-7-20-16(10-17)6-8-21(25)27-20/h3-10H,12-13H2,1-2H3,(H,28,30) |
| InChIKey | YHRAPXQMBXNZNA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|