C24H23ClN4O3 — CID 55730065
[2-[(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate (PubChem CID 55730065) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is [2-[(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-[(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55730065 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [2-[(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
| SMILES | Cc1c(C#N)c(NC(=O)COC(=O)c2ccc3nc(Cl)ccc3c2)n(C2CCCC2)c1C |
| InChI | InChI=1S/C24H23ClN4O3/c1-14-15(2)29(18-5-3-4-6-18)23(19(14)12-26)28-22(30)13-32-24(31)17-7-9-20-16(11-17)8-10-21(25)27-20/h7-11,18H,3-6,13H2,1-2H3,(H,28,30) |
| InChIKey | VZMMUVGBXDAYMR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|