C21H20ClF2N3O3 — CID 42490716
[2-[(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 42490716) has the molecular formula C21H20ClF2N3O3 and a molecular weight of 435.86 g/mol. Its IUPAC name is [2-[(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 42490716 |
| Molecular Formula | C21H20ClF2N3O3 |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [2-[(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | Cc1c(C#N)c(NC(=O)COC(=O)c2cc(F)c(F)cc2Cl)n(C2CCCC2)c1C |
| InChI | InChI=1S/C21H20ClF2N3O3/c1-11-12(2)27(13-5-3-4-6-13)20(15(11)9-25)26-19(28)10-30-21(29)14-7-17(23)18(24)8-16(14)22/h7-8,13H,3-6,10H2,1-2H3,(H,26,28) |
| InChIKey | QYMLWTHWRNVTAJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|