C23H20ClFN4O3 — CID 24520888
[2-[[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 24520888) has the molecular formula C23H20ClFN4O3 and a molecular weight of 454.89 g/mol. Its IUPAC name is [2-[[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-[[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 24520888 |
| Molecular Formula | C23H20ClFN4O3 |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [2-[[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | Cc1c(C#N)c(NC(=O)COC(=O)c2ccc(Cl)c(N)c2)n(Cc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C23H20ClFN4O3/c1-13-14(2)29(11-15-3-6-17(25)7-4-15)22(18(13)10-26)28-21(30)12-32-23(31)16-5-8-19(24)20(27)9-16/h3-9H,11-12,27H2,1-2H3,(H,28,30) |
| InChIKey | AFPTXOGZKZTFNA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|